C12H20KNO3 — CID 102117343
potassium 2-[methyl-[(E)-oct-5-enoyl]amino]propanoate (PubChem CID 102117343) has the molecular formula C12H20KNO3 and a molecular weight of 265.39 g/mol. Its IUPAC name is potassium 2-[methyl-[(E)-oct-5-enoyl]amino]propanoate.
| Compound Name | potassium 2-[methyl-[(E)-oct-5-enoyl]amino]propanoate |
|---|---|
| PubChem CID | 102117343 |
| Molecular Formula | C12H20KNO3 |
| Molecular Weight | 265.39 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | potassium 2-[methyl-[(E)-oct-5-enoyl]amino]propanoate |
| SMILES | CC/C=C/CCCC(=O)N(C)C(C)C(=O)[O-].[K+] |
| InChI | InChI=1S/C12H21NO3.K/c1-4-5-6-7-8-9-11(14)13(3)10(2)12(15)16;/h5-6,10H,4,7-9H2,1-3H3,(H,15,16);/q;+1/p-1/b6-5+; |
| InChIKey | QCWSJWFFVWDDDI-IPZCTEOASA-M |
| XLogP | -2.28 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.39 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|