C22H39NO — CID 122698321
(9Z,12Z,15Z)-N,N-diethyloctadeca-9,12,15-trienamide (PubChem CID 122698321) has the molecular formula C22H39NO and a molecular weight of 333.56 g/mol. Its IUPAC name is (9Z,12Z,15Z)-N,N-diethyloctadeca-9,12,15-trienamide.
| Compound Name | (9Z,12Z,15Z)-N,N-diethyloctadeca-9,12,15-trienamide |
|---|---|
| PubChem CID | 122698321 |
| Molecular Formula | C22H39NO |
| Molecular Weight | 333.56 g/mol |
| Exact Mass | 333.30 |
| IUPAC Name | (9Z,12Z,15Z)-N,N-diethyloctadeca-9,12,15-trienamide |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)N(CC)CC |
| InChI | InChI=1S/C22H39NO/c1-4-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(24)23(5-2)6-3/h7-8,10-11,13-14H,4-6,9,12,15-21H2,1-3H3/b8-7-,11-10-,14-13- |
| InChIKey | MWACGLHWWQNESE-JPFHKJGASA-N |
| XLogP | 6.44 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.56 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|