C12H20KNO3 — CID 101276406
potassium (E)-N-(3-carboxypropyl)oct-5-enimidate (PubChem CID 101276406) has the molecular formula C12H20KNO3 and a molecular weight of 265.39 g/mol. Its IUPAC name is potassium (E)-N-(3-carboxypropyl)oct-5-enimidate.
| Compound Name | potassium (E)-N-(3-carboxypropyl)oct-5-enimidate |
|---|---|
| PubChem CID | 101276406 |
| Molecular Formula | C12H20KNO3 |
| Molecular Weight | 265.39 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | potassium (E)-N-(3-carboxypropyl)oct-5-enimidate |
| SMILES | CC/C=C/CCC/C([O-])=N/CCCC(=O)O.[K+] |
| InChI | InChI=1S/C12H21NO3.K/c1-2-3-4-5-6-8-11(14)13-10-7-9-12(15)16;/h3-4H,2,5-10H2,1H3,(H,13,14)(H,15,16);/q;+1/p-1/b4-3+; |
| InChIKey | GDTUZPIGBMUPDF-BJILWQEISA-M |
| XLogP | -1.25 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.39 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|