C11H18NNaO3 — CID 101276347
sodium (E)-N-(2-carboxyethyl)oct-4-enimidate (PubChem CID 101276347) has the molecular formula C11H18NNaO3 and a molecular weight of 235.26 g/mol. Its IUPAC name is sodium (E)-N-(2-carboxyethyl)oct-4-enimidate.
| Compound Name | sodium (E)-N-(2-carboxyethyl)oct-4-enimidate |
|---|---|
| PubChem CID | 101276347 |
| Molecular Formula | C11H18NNaO3 |
| Molecular Weight | 235.26 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | sodium (E)-N-(2-carboxyethyl)oct-4-enimidate |
| SMILES | CCC/C=C/CC/C([O-])=N/CCC(=O)O.[Na+] |
| InChI | InChI=1S/C11H19NO3.Na/c1-2-3-4-5-6-7-10(13)12-9-8-11(14)15;/h4-5H,2-3,6-9H2,1H3,(H,12,13)(H,14,15);/q;+1/p-1/b5-4+; |
| InChIKey | ZZIFPUBFZAFPHV-FXRZFVDSSA-M |
| XLogP | -1.64 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.26 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|