C12H18KNO5 — CID 101284916
potassium (E)-N-[(1S)-1,3-dicarboxypropyl]hept-4-enimidate (PubChem CID 101284916) has the molecular formula C12H18KNO5 and a molecular weight of 295.38 g/mol. Its IUPAC name is potassium (E)-N-[(1S)-1,3-dicarboxypropyl]hept-4-enimidate.
| Compound Name | potassium (E)-N-[(1S)-1,3-dicarboxypropyl]hept-4-enimidate |
|---|---|
| PubChem CID | 101284916 |
| Molecular Formula | C12H18KNO5 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | potassium (E)-N-[(1S)-1,3-dicarboxypropyl]hept-4-enimidate |
| SMILES | CC/C=C/CC/C([O-])=N/[C@@H](CCC(=O)O)C(=O)O.[K+] |
| InChI | InChI=1S/C12H19NO5.K/c1-2-3-4-5-6-10(14)13-9(12(17)18)7-8-11(15)16;/h3-4,9H,2,5-8H2,1H3,(H,13,14)(H,15,16)(H,17,18);/q;+1/p-1/b4-3+;/t9-;/m0./s1 |
| InChIKey | GWQJBHQQUYXXKF-QSCMMIJTSA-M |
| XLogP | -2.19 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|