C12H17NNa2O5 — CID 101284910
disodium;(4S)-5-hydroxy-4-[[(E)-1-oxidohept-3-enylidene]amino]-5-oxopentanoate (PubChem CID 101284910) has the molecular formula C12H17NNa2O5 and a molecular weight of 301.25 g/mol. Its IUPAC name is disodium;(4S)-5-hydroxy-4-[[(E)-1-oxidohept-3-enylidene]amino]-5-oxopentanoate.
| Compound Name | disodium;(4S)-5-hydroxy-4-[[(E)-1-oxidohept-3-enylidene]amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 101284910 |
| Molecular Formula | C12H17NNa2O5 |
| Molecular Weight | 301.25 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | disodium;(4S)-5-hydroxy-4-[[(E)-1-oxidohept-3-enylidene]amino]-5-oxopentanoate |
| SMILES | CCC/C=C/C/C([O-])=N/[C@@H](CCC(=O)[O-])C(=O)O.[Na+].[Na+] |
| InChI | InChI=1S/C12H19NO5.2Na/c1-2-3-4-5-6-10(14)13-9(12(17)18)7-8-11(15)16;;/h4-5,9H,2-3,6-8H2,1H3,(H,13,14)(H,15,16)(H,17,18);;/q;2*+1/p-2/b5-4+;;/t9-;;/m0../s1 |
| InChIKey | VTOCMAGUTXIBEO-XKSMBETDSA-L |
| XLogP | -6.52 |
| TPSA | 112.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.25 |
| LogP ≤ 5 | -6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|