C10H14N2O7-2 — CID 131675934
(4S)-4-[[(4S)-4-amino-4-carboxy-1-oxidobutylidene]amino]-5-hydroxy-5-oxopentanoate (PubChem CID 131675934) has the molecular formula C10H14N2O7-2 and a molecular weight of 274.23 g/mol. Its IUPAC name is (4S)-4-[[(4S)-4-amino-4-carboxy-1-oxidobutylidene]amino]-5-hydroxy-5-oxopentanoate.
| Compound Name | (4S)-4-[[(4S)-4-amino-4-carboxy-1-oxidobutylidene]amino]-5-hydroxy-5-oxopentanoate |
|---|---|
| PubChem CID | 131675934 |
| Molecular Formula | C10H14N2O7-2 |
| Molecular Weight | 274.23 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | (4S)-4-[[(4S)-4-amino-4-carboxy-1-oxidobutylidene]amino]-5-hydroxy-5-oxopentanoate |
| SMILES | N[C@@H](CC/C([O-])=N/[C@@H](CCC(=O)[O-])C(=O)O)C(=O)O |
| InChI | InChI=1S/C10H16N2O7/c11-5(9(16)17)1-3-7(13)12-6(10(18)19)2-4-8(14)15/h5-6H,1-4,11H2,(H,12,13)(H,14,15)(H,16,17)(H,18,19)/p-2/t5-,6-/m0/s1 |
| InChIKey | OWQDWQKWSLFFFR-WDSKDSINSA-L |
| XLogP | -3.08 |
| TPSA | 176.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.23 |
| LogP ≤ 5 | -3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|