C11H16FNNa2O5 — CID 101278166
disodium;(4S)-4-[(3-fluoro-1-oxidohexylidene)amino]-5-hydroxy-5-oxopentanoate (PubChem CID 101278166) has the molecular formula C11H16FNNa2O5 and a molecular weight of 307.23 g/mol. Its IUPAC name is disodium;(4S)-4-[(3-fluoro-1-oxidohexylidene)amino]-5-hydroxy-5-oxopentanoate.
| Compound Name | disodium;(4S)-4-[(3-fluoro-1-oxidohexylidene)amino]-5-hydroxy-5-oxopentanoate |
|---|---|
| PubChem CID | 101278166 |
| Molecular Formula | C11H16FNNa2O5 |
| Molecular Weight | 307.23 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | disodium;(4S)-4-[(3-fluoro-1-oxidohexylidene)amino]-5-hydroxy-5-oxopentanoate |
| SMILES | CCCC(F)C/C([O-])=N/[C@@H](CCC(=O)[O-])C(=O)O.[Na+].[Na+] |
| InChI | InChI=1S/C11H18FNO5.2Na/c1-2-3-7(12)6-9(14)13-8(11(17)18)4-5-10(15)16;;/h7-8H,2-6H2,1H3,(H,13,14)(H,15,16)(H,17,18);;/q;2*+1/p-2/t7?,8-;;/m0../s1 |
| InChIKey | ZMJXVQUDVOITBI-AEUOCKLGSA-L |
| XLogP | -6.74 |
| TPSA | 112.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.23 |
| LogP ≤ 5 | -6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|