About sodium 4-fluoroheptanoate
sodium 4-fluoroheptanoate (PubChem CID 101279242) has the molecular formula C7H12FNaO2
and a molecular weight of 170.16 g/mol. Its IUPAC name is sodium 4-fluoroheptanoate.
Molecular Properties
| Compound Name | sodium 4-fluoroheptanoate |
| PubChem CID | 101279242 |
| Molecular Formula | C7H12FNaO2 |
| Molecular Weight | 170.16 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | sodium 4-fluoroheptanoate |
| SMILES | CCCC(F)CCC(=O)[O-].[Na+] |
| InChI | InChI=1S/C7H13FO2.Na/c1-2-3-6(8)4-5-7(9)10;/h6H,2-5H2,1H3,(H,9,10);/q;+1/p-1 |
| InChIKey | WWQBJBLBWRLXSH-UHFFFAOYSA-M |
| XLogP | -2.34 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.16 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze sodium 4-fluoroheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 4-fluoroheptanoate?
The IUPAC name of sodium 4-fluoroheptanoate (CID 101279242) is sodium 4-fluoroheptanoate.
What is the SMILES notation for sodium 4-fluoroheptanoate?
The canonical SMILES for sodium 4-fluoroheptanoate is CCCC(F)CCC(=O)[O-].[Na+].
What is the InChIKey of sodium 4-fluoroheptanoate?
The InChIKey is WWQBJBLBWRLXSH-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H13FO2.Na/c1-2-3-6(8)4-5-7(9)10;/h6H,2-5H2,1H3,(H,9,10);/q;+1/p-1.
What are the key properties of sodium 4-fluoroheptanoate?
sodium 4-fluoroheptanoate has a molecular weight of 170.16 g/mol, XLogP of -2.34, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 4-fluoroheptanoate is sourced from PubChem (CID 101279242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).