sodium 4-fluoroheptanoate

C7H12FNaO2 — CID 101279242

IUPACsodium 4-fluoroheptanoate
SMILESCCCC(F)CCC(=O)[O-].[Na+]
InChIInChI=1S/C7H13FO2.Na/c1-2-3-6(8)4-5-7(9)10;/h6H,2-5H2,1H3,(H,9,10);/q;+1/p-1
InChIKeyWWQBJBLBWRLXSH-UHFFFAOYSA-M
MW170.16 g/mol
LogP-2.34
Rot. Bonds5

About sodium 4-fluoroheptanoate

sodium 4-fluoroheptanoate (PubChem CID 101279242) has the molecular formula C7H12FNaO2 and a molecular weight of 170.16 g/mol. Its IUPAC name is sodium 4-fluoroheptanoate.

Molecular Properties

Compound Namesodium 4-fluoroheptanoate
PubChem CID101279242
Molecular FormulaC7H12FNaO2
Molecular Weight170.16 g/mol
Exact Mass170.07
IUPAC Namesodium 4-fluoroheptanoate
SMILESCCCC(F)CCC(=O)[O-].[Na+]
InChIInChI=1S/C7H13FO2.Na/c1-2-3-6(8)4-5-7(9)10;/h6H,2-5H2,1H3,(H,9,10);/q;+1/p-1
InChIKeyWWQBJBLBWRLXSH-UHFFFAOYSA-M
XLogP-2.34
TPSA40.13 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500170.16
LogP ≤ 5-2.34
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze sodium 4-fluoroheptanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 4-fluoroheptanoate?
The IUPAC name of sodium 4-fluoroheptanoate (CID 101279242) is sodium 4-fluoroheptanoate.
What is the SMILES notation for sodium 4-fluoroheptanoate?
The canonical SMILES for sodium 4-fluoroheptanoate is CCCC(F)CCC(=O)[O-].[Na+].
What is the InChIKey of sodium 4-fluoroheptanoate?
The InChIKey is WWQBJBLBWRLXSH-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H13FO2.Na/c1-2-3-6(8)4-5-7(9)10;/h6H,2-5H2,1H3,(H,9,10);/q;+1/p-1.
What are the key properties of sodium 4-fluoroheptanoate?
sodium 4-fluoroheptanoate has a molecular weight of 170.16 g/mol, XLogP of -2.34, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 4-fluoroheptanoate is sourced from PubChem (CID 101279242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).