About calcium bis(4-fluorononanoate)
calcium bis(4-fluorononanoate) (PubChem CID 101279306) has the molecular formula C18H32CaF2O4
and a molecular weight of 390.52 g/mol. Its IUPAC name is calcium bis(4-fluorononanoate).
Molecular Properties
| Compound Name | calcium bis(4-fluorononanoate) |
| PubChem CID | 101279306 |
| Molecular Formula | C18H32CaF2O4 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | calcium bis(4-fluorononanoate) |
| SMILES | CCCCCC(F)CCC(=O)[O-].CCCCCC(F)CCC(=O)[O-].[Ca+2] |
| InChI | InChI=1S/2C9H17FO2.Ca/c2*1-2-3-4-5-8(10)6-7-9(11)12;/h2*8H,2-7H2,1H3,(H,11,12);/q;;+2/p-2 |
| InChIKey | JZYOTGLFWOLSPK-UHFFFAOYSA-L |
| XLogP | 2.49 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze calcium bis(4-fluorononanoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium bis(4-fluorononanoate)?
The IUPAC name of calcium bis(4-fluorononanoate) (CID 101279306) is calcium bis(4-fluorononanoate).
What is the SMILES notation for calcium bis(4-fluorononanoate)?
The canonical SMILES for calcium bis(4-fluorononanoate) is CCCCCC(F)CCC(=O)[O-].CCCCCC(F)CCC(=O)[O-].[Ca+2].
What is the InChIKey of calcium bis(4-fluorononanoate)?
The InChIKey is JZYOTGLFWOLSPK-UHFFFAOYSA-L. The full InChI is InChI=1S/2C9H17FO2.Ca/c2*1-2-3-4-5-8(10)6-7-9(11)12;/h2*8H,2-7H2,1H3,(H,11,12);/q;;+2/p-2.
What are the key properties of calcium bis(4-fluorononanoate)?
calcium bis(4-fluorononanoate) has a molecular weight of 390.52 g/mol, XLogP of 2.49, 14 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for calcium bis(4-fluorononanoate) is sourced from PubChem (CID 101279306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).