C23H43N3O2 — CID 102116531
(E)-N-[1-[methyl-[2-[[(E)-oct-5-enoyl]amino]propyl]amino]propan-2-yl]oct-5-enamide (PubChem CID 102116531) has the molecular formula C23H43N3O2 and a molecular weight of 393.62 g/mol. Its IUPAC name is (E)-N-[1-[methyl-[2-[[(E)-oct-5-enoyl]amino]propyl]amino]propan-2-yl]oct-5-enamide.
| Compound Name | (E)-N-[1-[methyl-[2-[[(E)-oct-5-enoyl]amino]propyl]amino]propan-2-yl]oct-5-enamide |
|---|---|
| PubChem CID | 102116531 |
| Molecular Formula | C23H43N3O2 |
| Molecular Weight | 393.62 g/mol |
| Exact Mass | 393.34 |
| IUPAC Name | (E)-N-[1-[methyl-[2-[[(E)-oct-5-enoyl]amino]propyl]amino]propan-2-yl]oct-5-enamide |
| SMILES | CC/C=C/CCCC(=O)NC(C)CN(C)CC(C)NC(=O)CCC/C=C/CC |
| InChI | InChI=1S/C23H43N3O2/c1-6-8-10-12-14-16-22(27)24-20(3)18-26(5)19-21(4)25-23(28)17-15-13-11-9-7-2/h8-11,20-21H,6-7,12-19H2,1-5H3,(H,24,27)(H,25,28)/b10-8+,11-9+ |
| InChIKey | ITPPXFNBDAXBRY-GFULKKFKSA-N |
| XLogP | 4.20 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.62 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|