C24H45N3O2 — CID 102116556
(E)-N-[1-[ethyl-[2-[[(E)-oct-6-enoyl]amino]propyl]amino]propan-2-yl]oct-6-enamide (PubChem CID 102116556) has the molecular formula C24H45N3O2 and a molecular weight of 407.64 g/mol. Its IUPAC name is (E)-N-[1-[ethyl-[2-[[(E)-oct-6-enoyl]amino]propyl]amino]propan-2-yl]oct-6-enamide.
| Compound Name | (E)-N-[1-[ethyl-[2-[[(E)-oct-6-enoyl]amino]propyl]amino]propan-2-yl]oct-6-enamide |
|---|---|
| PubChem CID | 102116556 |
| Molecular Formula | C24H45N3O2 |
| Molecular Weight | 407.64 g/mol |
| Exact Mass | 407.35 |
| IUPAC Name | (E)-N-[1-[ethyl-[2-[[(E)-oct-6-enoyl]amino]propyl]amino]propan-2-yl]oct-6-enamide |
| SMILES | C/C=C/CCCCC(=O)NC(C)CN(CC)CC(C)NC(=O)CCCC/C=C/C |
| InChI | InChI=1S/C24H45N3O2/c1-6-9-11-13-15-17-23(28)25-21(4)19-27(8-3)20-22(5)26-24(29)18-16-14-12-10-7-2/h6-7,9-10,21-22H,8,11-20H2,1-5H3,(H,25,28)(H,26,29)/b9-6+,10-7+ |
| InChIKey | LLQMAPAHNLIOND-KZZDLZNXSA-N |
| XLogP | 4.59 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.64 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|