C48H74O2 — CID 159107554
(7Z,10Z,13Z,16Z,19Z)-2-methyldocosa-7,10,13,16,19-pentaen-3-one;(6Z,9Z,12Z,15Z,18Z,21Z)-2-methyltetracosa-6,9,12,15,18,21-hexaen-3-one (PubChem CID 159107554) has the molecular formula C48H74O2 and a molecular weight of 683.12 g/mol. Its IUPAC name is (7Z,10Z,13Z,16Z,19Z)-2-methyldocosa-7,10,13,16,19-pentaen-3-one;(6Z,9Z,12Z,15Z,18Z,21Z)-2-methyltetracosa-6,9,12,15,18,21-hexaen-3-one.
| Compound Name | (7Z,10Z,13Z,16Z,19Z)-2-methyldocosa-7,10,13,16,19-pentaen-3-one;(6Z,9Z,12Z,15Z,18Z,21Z)-2-methyltetracosa-6,9,12,15,18,21-hexaen-3-one |
|---|---|
| PubChem CID | 159107554 |
| Molecular Formula | C48H74O2 |
| Molecular Weight | 683.12 g/mol |
| Exact Mass | 682.57 |
| IUPAC Name | (7Z,10Z,13Z,16Z,19Z)-2-methyldocosa-7,10,13,16,19-pentaen-3-one;(6Z,9Z,12Z,15Z,18Z,21Z)-2-methyltetracosa-6,9,12,15,18,21-hexaen-3-one |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)C(C)C.CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)C(C)C |
| InChI | InChI=1S/C25H38O.C23H36O/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-25(26)24(2)3;1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-23(24)22(2)3/h5-6,8-9,11-12,14-15,17-18,20-21,24H,4,7,10,13,16,19,22-23H2,1-3H3;5-6,8-9,11-12,14-15,17-18,22H,4,7,10,13,16,19-21H2,1-3H3/b6-5-,9-8-,12-11-,15-14-,18-17-,21-20-;6-5-,9-8-,12-11-,15-14-,18-17- |
| InChIKey | KEBSABUOUARXQA-FIAQIACWSA-N |
| XLogP | 14.82 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.12 |
| LogP ≤ 5 | 14.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|