C21H37NO — CID 141060806
(12Z,15Z,18Z)-3-aminohenicosa-12,15,18-trien-4-one (PubChem CID 141060806) has the molecular formula C21H37NO and a molecular weight of 319.53 g/mol. Its IUPAC name is (12Z,15Z,18Z)-3-aminohenicosa-12,15,18-trien-4-one.
| Compound Name | (12Z,15Z,18Z)-3-aminohenicosa-12,15,18-trien-4-one |
|---|---|
| PubChem CID | 141060806 |
| Molecular Formula | C21H37NO |
| Molecular Weight | 319.53 g/mol |
| Exact Mass | 319.29 |
| IUPAC Name | (12Z,15Z,18Z)-3-aminohenicosa-12,15,18-trien-4-one |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)C(N)CC |
| InChI | InChI=1S/C21H37NO/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21(23)20(22)4-2/h5-6,8-9,11-12,20H,3-4,7,10,13-19,22H2,1-2H3/b6-5-,9-8-,12-11- |
| InChIKey | PZCGQQGUZXRGOO-AGRJPVHOSA-N |
| XLogP | 5.88 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.53 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|