C26H44O — CID 140679119
(7Z,11Z,15Z,19Z)-2-methylpentacosa-7,11,15,19-tetraen-3-one (PubChem CID 140679119) has the molecular formula C26H44O and a molecular weight of 372.64 g/mol. Its IUPAC name is (7Z,11Z,15Z,19Z)-2-methylpentacosa-7,11,15,19-tetraen-3-one.
| Compound Name | (7Z,11Z,15Z,19Z)-2-methylpentacosa-7,11,15,19-tetraen-3-one |
|---|---|
| PubChem CID | 140679119 |
| Molecular Formula | C26H44O |
| Molecular Weight | 372.64 g/mol |
| Exact Mass | 372.34 |
| IUPAC Name | (7Z,11Z,15Z,19Z)-2-methylpentacosa-7,11,15,19-tetraen-3-one |
| SMILES | CCCCC/C=C\CC/C=C\CC/C=C\CC/C=C\CCCC(=O)C(C)C |
| InChI | InChI=1S/C26H44O/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-26(27)25(2)3/h8-9,12-13,16-17,20-21,25H,4-7,10-11,14-15,18-19,22-24H2,1-3H3/b9-8-,13-12-,17-16-,21-20- |
| InChIKey | UEFDLKHJLZXAQT-LMJAJTSOSA-N |
| XLogP | 8.53 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.64 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|