C7H12F2 — CID 54444112
7,7-difluorohept-3-ene (PubChem CID 54444112) has the molecular formula C7H12F2 and a molecular weight of 134.17 g/mol. Its IUPAC name is 7,7-difluorohept-3-ene.
| Compound Name | 7,7-difluorohept-3-ene |
|---|---|
| PubChem CID | 54444112 |
| Molecular Formula | C7H12F2 |
| Molecular Weight | 134.17 g/mol |
| Exact Mass | 134.09 |
| IUPAC Name | 7,7-difluorohept-3-ene |
| SMILES | CCC=CCCC(F)F |
| InChI | InChI=1S/C7H12F2/c1-2-3-4-5-6-7(8)9/h3-4,7H,2,5-6H2,1H3 |
| InChIKey | CRIHGDFJRGTLSC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.17 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|