C9H12F6 — CID 123611335
8,8,8-trifluoro-7-(trifluoromethyl)oct-3-ene (PubChem CID 123611335) has the molecular formula C9H12F6 and a molecular weight of 234.18 g/mol. Its IUPAC name is 8,8,8-trifluoro-7-(trifluoromethyl)oct-3-ene.
| Compound Name | 8,8,8-trifluoro-7-(trifluoromethyl)oct-3-ene |
|---|---|
| PubChem CID | 123611335 |
| Molecular Formula | C9H12F6 |
| Molecular Weight | 234.18 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 8,8,8-trifluoro-7-(trifluoromethyl)oct-3-ene |
| SMILES | CCC=CCCC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H12F6/c1-2-3-4-5-6-7(8(10,11)12)9(13,14)15/h3-4,7H,2,5-6H2,1H3 |
| InChIKey | CZWTWAAYRAUDGK-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.18 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|