C13H25NO — CID 134962587
(3S)-N,N-dimethyl-3-propyloct-7-enamide (PubChem CID 134962587) has the molecular formula C13H25NO and a molecular weight of 211.35 g/mol. Its IUPAC name is (3S)-N,N-dimethyl-3-propyloct-7-enamide.
| Compound Name | (3S)-N,N-dimethyl-3-propyloct-7-enamide |
|---|---|
| PubChem CID | 134962587 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | (3S)-N,N-dimethyl-3-propyloct-7-enamide |
| SMILES | C=CCCCC(CCC)CC(=O)N(C)C |
| InChI | InChI=1S/C13H25NO/c1-5-7-8-10-12(9-6-2)11-13(15)14(3)4/h5,12H,1,6-11H2,2-4H3 |
| InChIKey | OGMBMTCSZHTSMU-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|