C10H18O — CID 134921683
(E,5R)-5,6,6-trimethylhept-2-en-4-one (PubChem CID 134921683) has the molecular formula C10H18O and a molecular weight of 154.25 g/mol. Its IUPAC name is (E,5R)-5,6,6-trimethylhept-2-en-4-one.
| Compound Name | (E,5R)-5,6,6-trimethylhept-2-en-4-one |
|---|---|
| PubChem CID | 134921683 |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 g/mol |
| Exact Mass | 154.14 |
| IUPAC Name | (E,5R)-5,6,6-trimethylhept-2-en-4-one |
| SMILES | C/C=C/C(=O)[C@H](C)C(C)(C)C |
| InChI | InChI=1S/C10H18O/c1-6-7-9(11)8(2)10(3,4)5/h6-8H,1-5H3/b7-6+/t8-/m0/s1 |
| InChIKey | RNXPYRKVKAZJIE-CZEYKFRCSA-N |
| XLogP | 2.81 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.25 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|