C8H14O2 — CID 100976633
(E,5R)-5-hydroxy-6-methylhept-2-en-4-one (PubChem CID 100976633) has the molecular formula C8H14O2 and a molecular weight of 142.20 g/mol. Its IUPAC name is (E,5R)-5-hydroxy-6-methylhept-2-en-4-one.
| Compound Name | (E,5R)-5-hydroxy-6-methylhept-2-en-4-one |
|---|---|
| PubChem CID | 100976633 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | (E,5R)-5-hydroxy-6-methylhept-2-en-4-one |
| SMILES | C/C=C/C(=O)[C@H](O)C(C)C |
| InChI | InChI=1S/C8H14O2/c1-4-5-7(9)8(10)6(2)3/h4-6,8,10H,1-3H3/b5-4+/t8-/m1/s1 |
| InChIKey | PISGFDGTPRVQLD-WTSVBCDHSA-N |
| XLogP | 1.15 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|