C7H12O5S — CID 173131410
3-hydroxy-4-oxohept-5-ene-1-sulfonic acid (PubChem CID 173131410) has the molecular formula C7H12O5S and a molecular weight of 208.23 g/mol. Its IUPAC name is 3-hydroxy-4-oxohept-5-ene-1-sulfonic acid.
| Compound Name | 3-hydroxy-4-oxohept-5-ene-1-sulfonic acid |
|---|---|
| PubChem CID | 173131410 |
| Molecular Formula | C7H12O5S |
| Molecular Weight | 208.23 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | 3-hydroxy-4-oxohept-5-ene-1-sulfonic acid |
| SMILES | CC=CC(=O)C(O)CCS(=O)(=O)O |
| InChI | InChI=1S/C7H12O5S/c1-2-3-6(8)7(9)4-5-13(10,11)12/h2-3,7,9H,4-5H2,1H3,(H,10,11,12) |
| InChIKey | IRDBYBQAAOVRJP-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.23 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|