C13H26NO5S+ — CID 175314619
but-2-enoyloxymethyl-diethyl-(4-sulfobutan-2-yl)azanium (PubChem CID 175314619) has the molecular formula C13H26NO5S+ and a molecular weight of 308.42 g/mol. Its IUPAC name is but-2-enoyloxymethyl-diethyl-(4-sulfobutan-2-yl)azanium.
| Compound Name | but-2-enoyloxymethyl-diethyl-(4-sulfobutan-2-yl)azanium |
|---|---|
| PubChem CID | 175314619 |
| Molecular Formula | C13H26NO5S+ |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | but-2-enoyloxymethyl-diethyl-(4-sulfobutan-2-yl)azanium |
| SMILES | CC=CC(=O)OC[N+](CC)(CC)C(C)CCS(=O)(=O)O |
| InChI | InChI=1S/C13H25NO5S/c1-5-8-13(15)19-11-14(6-2,7-3)12(4)9-10-20(16,17)18/h5,8,12H,6-7,9-11H2,1-4H3/p+1 |
| InChIKey | YKIOSNCRHOBQSA-UHFFFAOYSA-O |
| XLogP | 1.59 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|