C15H23NaO9S — CID 174919457
sodium;3-but-2-enoyloxy-2-(but-2-enoyloxymethyl)propanoic acid;propane-1-sulfonic acid (PubChem CID 174919457) has the molecular formula C15H23NaO9S and a molecular weight of 402.40 g/mol. Its IUPAC name is sodium;3-but-2-enoyloxy-2-(but-2-enoyloxymethyl)propanoic acid;propane-1-sulfonic acid.
| Compound Name | sodium;3-but-2-enoyloxy-2-(but-2-enoyloxymethyl)propanoic acid;propane-1-sulfonic acid |
|---|---|
| PubChem CID | 174919457 |
| Molecular Formula | C15H23NaO9S |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | sodium;3-but-2-enoyloxy-2-(but-2-enoyloxymethyl)propanoic acid;propane-1-sulfonic acid |
| SMILES | CC=CC(=O)OCC(COC(=O)C=CC)C(=O)O.[CH2-]CCS(=O)(=O)O.[Na+] |
| InChI | InChI=1S/C12H16O6.C3H7O3S.Na/c1-3-5-10(13)17-7-9(12(15)16)8-18-11(14)6-4-2;1-2-3-7(4,5)6;/h3-6,9H,7-8H2,1-2H3,(H,15,16);1-3H2,(H,4,5,6);/q;-1;+1 |
| InChIKey | UHXXTTHGCAIEIN-UHFFFAOYSA-N |
| XLogP | -1.97 |
| TPSA | 144.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|