C11H19LiO7S — CID 174803163
lithium;3-but-2-enoyloxy-2-methylpropanoic acid;propane-2-sulfonic acid (PubChem CID 174803163) has the molecular formula C11H19LiO7S and a molecular weight of 302.27 g/mol. Its IUPAC name is lithium;3-but-2-enoyloxy-2-methylpropanoic acid;propane-2-sulfonic acid.
| Compound Name | lithium;3-but-2-enoyloxy-2-methylpropanoic acid;propane-2-sulfonic acid |
|---|---|
| PubChem CID | 174803163 |
| Molecular Formula | C11H19LiO7S |
| Molecular Weight | 302.27 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | lithium;3-but-2-enoyloxy-2-methylpropanoic acid;propane-2-sulfonic acid |
| SMILES | CC=CC(=O)OCC(C)C(=O)O.[CH2-]C(C)S(=O)(=O)O.[Li+] |
| InChI | InChI=1S/C8H12O4.C3H7O3S.Li/c1-3-4-7(9)12-5-6(2)8(10)11;1-3(2)7(4,5)6;/h3-4,6H,5H2,1-2H3,(H,10,11);3H,1H2,2H3,(H,4,5,6);/q;-1;+1 |
| InChIKey | WKHMGVLYLNYALK-UHFFFAOYSA-N |
| XLogP | -2.07 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.27 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|