C13H23NaO7S — CID 174802827
sodium;2-(but-2-enoyloxymethyl)pentanoic acid;propane-1-sulfonic acid (PubChem CID 174802827) has the molecular formula C13H23NaO7S and a molecular weight of 346.38 g/mol. Its IUPAC name is sodium;2-(but-2-enoyloxymethyl)pentanoic acid;propane-1-sulfonic acid.
| Compound Name | sodium;2-(but-2-enoyloxymethyl)pentanoic acid;propane-1-sulfonic acid |
|---|---|
| PubChem CID | 174802827 |
| Molecular Formula | C13H23NaO7S |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | sodium;2-(but-2-enoyloxymethyl)pentanoic acid;propane-1-sulfonic acid |
| SMILES | CC=CC(=O)OCC(CCC)C(=O)O.[CH2-]CCS(=O)(=O)O.[Na+] |
| InChI | InChI=1S/C10H16O4.C3H7O3S.Na/c1-3-5-8(10(12)13)7-14-9(11)6-4-2;1-2-3-7(4,5)6;/h4,6,8H,3,5,7H2,1-2H3,(H,12,13);1-3H2,(H,4,5,6);/q;-1;+1 |
| InChIKey | FCMNAPDFKGBBFP-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|