C16H31NO5S — CID 174880339
3-[(2-hydroxy-3-oxohex-4-enyl)-dipropylazaniumyl]butane-1-sulfonate (PubChem CID 174880339) has the molecular formula C16H31NO5S and a molecular weight of 349.49 g/mol. Its IUPAC name is 3-[(2-hydroxy-3-oxohex-4-enyl)-dipropylazaniumyl]butane-1-sulfonate.
| Compound Name | 3-[(2-hydroxy-3-oxohex-4-enyl)-dipropylazaniumyl]butane-1-sulfonate |
|---|---|
| PubChem CID | 174880339 |
| Molecular Formula | C16H31NO5S |
| Molecular Weight | 349.49 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | 3-[(2-hydroxy-3-oxohex-4-enyl)-dipropylazaniumyl]butane-1-sulfonate |
| SMILES | CC=CC(=O)C(O)C[N+](CCC)(CCC)C(C)CCS(=O)(=O)[O-] |
| InChI | InChI=1S/C16H31NO5S/c1-5-8-15(18)16(19)13-17(10-6-2,11-7-3)14(4)9-12-23(20,21)22/h5,8,14,16,19H,6-7,9-13H2,1-4H3 |
| InChIKey | SUMQKYSHFNTBRT-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 94.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.49 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|