About lithium;hydride;3-methylbutane-1-sulfonic acid
lithium;hydride;3-methylbutane-1-sulfonic acid (PubChem CID 174653708) has the molecular formula C5H13LiO3S
and a molecular weight of 160.16 g/mol. Its IUPAC name is lithium;hydride;3-methylbutane-1-sulfonic acid.
Molecular Properties
| Compound Name | lithium;hydride;3-methylbutane-1-sulfonic acid |
| PubChem CID | 174653708 |
| Molecular Formula | C5H13LiO3S |
| Molecular Weight | 160.16 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | lithium;hydride;3-methylbutane-1-sulfonic acid |
| SMILES | CC(C)CCS(=O)(=O)O.[H-].[Li+] |
| InChI | InChI=1S/C5H12O3S.Li.H/c1-5(2)3-4-9(6,7)8;;/h5H,3-4H2,1-2H3,(H,6,7,8);;/q;+1;-1 |
| InChIKey | UGEJIPRIPSPGLG-UHFFFAOYSA-N |
| XLogP | -1.96 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.16 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze lithium;hydride;3-methylbutane-1-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;hydride;3-methylbutane-1-sulfonic acid?
The IUPAC name of lithium;hydride;3-methylbutane-1-sulfonic acid (CID 174653708) is lithium;hydride;3-methylbutane-1-sulfonic acid.
What is the SMILES notation for lithium;hydride;3-methylbutane-1-sulfonic acid?
The canonical SMILES for lithium;hydride;3-methylbutane-1-sulfonic acid is CC(C)CCS(=O)(=O)O.[H-].[Li+].
What is the InChIKey of lithium;hydride;3-methylbutane-1-sulfonic acid?
The InChIKey is UGEJIPRIPSPGLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12O3S.Li.H/c1-5(2)3-4-9(6,7)8;;/h5H,3-4H2,1-2H3,(H,6,7,8);;/q;+1;-1.
What are the key properties of lithium;hydride;3-methylbutane-1-sulfonic acid?
lithium;hydride;3-methylbutane-1-sulfonic acid has a molecular weight of 160.16 g/mol, XLogP of -1.96, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;hydride;3-methylbutane-1-sulfonic acid is sourced from PubChem (CID 174653708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).