C12H24O4Si — CID 123376782
7-[diethoxy(methyl)silyl]-5-hydroxyhept-2-en-4-one (PubChem CID 123376782) has the molecular formula C12H24O4Si and a molecular weight of 260.41 g/mol. Its IUPAC name is 7-[diethoxy(methyl)silyl]-5-hydroxyhept-2-en-4-one.
| Compound Name | 7-[diethoxy(methyl)silyl]-5-hydroxyhept-2-en-4-one |
|---|---|
| PubChem CID | 123376782 |
| Molecular Formula | C12H24O4Si |
| Molecular Weight | 260.41 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 7-[diethoxy(methyl)silyl]-5-hydroxyhept-2-en-4-one |
| SMILES | CC=CC(=O)C(O)CC[Si](C)(OCC)OCC |
| InChI | InChI=1S/C12H24O4Si/c1-5-8-11(13)12(14)9-10-17(4,15-6-2)16-7-3/h5,8,12,14H,6-7,9-10H2,1-4H3 |
| InChIKey | MXBVFONQOLVEDV-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.41 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|