C13H25NO2 — CID 59432218
(Z)-2-(3,3-dimethylbutan-2-yl)-3-hydroxy-4,4-dimethylpent-2-enamide (PubChem CID 59432218) has the molecular formula C13H25NO2 and a molecular weight of 227.35 g/mol. Its IUPAC name is (Z)-2-(3,3-dimethylbutan-2-yl)-3-hydroxy-4,4-dimethylpent-2-enamide.
| Compound Name | (Z)-2-(3,3-dimethylbutan-2-yl)-3-hydroxy-4,4-dimethylpent-2-enamide |
|---|---|
| PubChem CID | 59432218 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | (Z)-2-(3,3-dimethylbutan-2-yl)-3-hydroxy-4,4-dimethylpent-2-enamide |
| SMILES | CC(/C(C(N)=O)=C(/O)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C13H25NO2/c1-8(12(2,3)4)9(11(14)16)10(15)13(5,6)7/h8,15H,1-7H3,(H2,14,16)/b10-9- |
| InChIKey | CCJLPRLXVLLGDB-KTKRTIGZSA-N |
| XLogP | 3.01 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|