C9H14O — CID 118181315
(3Z)-5-[(E)-prop-1-enoxy]hexa-1,3-diene (PubChem CID 118181315) has the molecular formula C9H14O and a molecular weight of 138.21 g/mol. Its IUPAC name is (3Z)-5-[(E)-prop-1-enoxy]hexa-1,3-diene.
| Compound Name | (3Z)-5-[(E)-prop-1-enoxy]hexa-1,3-diene |
|---|---|
| PubChem CID | 118181315 |
| Molecular Formula | C9H14O |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.10 |
| IUPAC Name | (3Z)-5-[(E)-prop-1-enoxy]hexa-1,3-diene |
| SMILES | C=C/C=C\C(C)O/C=C/C |
| InChI | InChI=1S/C9H14O/c1-4-6-7-9(3)10-8-5-2/h4-9H,1H2,2-3H3/b7-6-,8-5+ |
| InChIKey | YGHIFLOUJDXFSO-WNXMRAAYSA-N |
| XLogP | 2.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|