C42H60 — CID 143867717
(4Z)-7,8-diethyl-2,7,8,9-tetramethyl-6-methylidenedeca-2,4-diene;1-methyl-3-phenylbenzene;1,2,3,5-tetramethylbenzene (PubChem CID 143867717) has the molecular formula C42H60 and a molecular weight of 564.94 g/mol. Its IUPAC name is (4Z)-7,8-diethyl-2,7,8,9-tetramethyl-6-methylidenedeca-2,4-diene;1-methyl-3-phenylbenzene;1,2,3,5-tetramethylbenzene.
| Compound Name | (4Z)-7,8-diethyl-2,7,8,9-tetramethyl-6-methylidenedeca-2,4-diene;1-methyl-3-phenylbenzene;1,2,3,5-tetramethylbenzene |
|---|---|
| PubChem CID | 143867717 |
| Molecular Formula | C42H60 |
| Molecular Weight | 564.94 g/mol |
| Exact Mass | 564.47 |
| IUPAC Name | (4Z)-7,8-diethyl-2,7,8,9-tetramethyl-6-methylidenedeca-2,4-diene;1-methyl-3-phenylbenzene;1,2,3,5-tetramethylbenzene |
| SMILES | C=C(/C=C\C=C(C)C)C(C)(CC)C(C)(CC)C(C)C.Cc1cc(C)c(C)c(C)c1.Cc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C19H34.C13H12.C10H14/c1-10-18(8,16(5)6)19(9,11-2)17(7)14-12-13-15(3)4;1-11-6-5-9-13(10-11)12-7-3-2-4-8-12;1-7-5-8(2)10(4)9(3)6-7/h12-14,16H,7,10-11H2,1-6,8-9H3;2-10H,1H3;5-6H,1-4H3/b14-12-;; |
| InChIKey | RTUSWVCZLHYFMX-NEKXZPCZSA-N |
| XLogP | 13.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.94 |
| LogP ≤ 5 | 13.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|