C19H28F2 — CID 167071654
(4E,7E,9Z)-2,2-difluoro-5,7,13-trimethyl-3,11-dimethylidenetetradeca-4,7,9-triene (PubChem CID 167071654) has the molecular formula C19H28F2 and a molecular weight of 294.43 g/mol. Its IUPAC name is (4E,7E,9Z)-2,2-difluoro-5,7,13-trimethyl-3,11-dimethylidenetetradeca-4,7,9-triene.
| Compound Name | (4E,7E,9Z)-2,2-difluoro-5,7,13-trimethyl-3,11-dimethylidenetetradeca-4,7,9-triene |
|---|---|
| PubChem CID | 167071654 |
| Molecular Formula | C19H28F2 |
| Molecular Weight | 294.43 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | (4E,7E,9Z)-2,2-difluoro-5,7,13-trimethyl-3,11-dimethylidenetetradeca-4,7,9-triene |
| SMILES | C=C(/C=C\C=C(/C)C/C(C)=C/C(=C)C(C)(F)F)CC(C)C |
| InChI | InChI=1S/C19H28F2/c1-14(2)11-15(3)9-8-10-16(4)12-17(5)13-18(6)19(7,20)21/h8-10,13-14H,3,6,11-12H2,1-2,4-5,7H3/b9-8-,16-10+,17-13+ |
| InChIKey | VOOOQJCCIONQFC-LFKZQVQISA-N |
| XLogP | 6.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.43 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|