C12H21N — CID 142937124
(3Z)-N,N-diethyl-5-methylidenehepta-1,3-dien-2-amine (PubChem CID 142937124) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is (3Z)-N,N-diethyl-5-methylidenehepta-1,3-dien-2-amine.
| Compound Name | (3Z)-N,N-diethyl-5-methylidenehepta-1,3-dien-2-amine |
|---|---|
| PubChem CID | 142937124 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | (3Z)-N,N-diethyl-5-methylidenehepta-1,3-dien-2-amine |
| SMILES | C=C(/C=C\C(=C)N(CC)CC)CC |
| InChI | InChI=1S/C12H21N/c1-6-11(4)9-10-12(5)13(7-2)8-3/h9-10H,4-8H2,1-3H3/b10-9- |
| InChIKey | WGEMVRSGQJRJJY-KTKRTIGZSA-N |
| XLogP | 3.36 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|