C21H43N — CID 166852744
N,6,6,10,10,14-hexamethylpentadec-14-en-1-amine (PubChem CID 166852744) has the molecular formula C21H43N and a molecular weight of 309.58 g/mol. Its IUPAC name is N,6,6,10,10,14-hexamethylpentadec-14-en-1-amine.
| Compound Name | N,6,6,10,10,14-hexamethylpentadec-14-en-1-amine |
|---|---|
| PubChem CID | 166852744 |
| Molecular Formula | C21H43N |
| Molecular Weight | 309.58 g/mol |
| Exact Mass | 309.34 |
| IUPAC Name | N,6,6,10,10,14-hexamethylpentadec-14-en-1-amine |
| SMILES | C=C(C)CCCC(C)(C)CCCC(C)(C)CCCCCNC |
| InChI | InChI=1S/C21H43N/c1-19(2)13-11-15-21(5,6)17-12-16-20(3,4)14-9-8-10-18-22-7/h22H,1,8-18H2,2-7H3 |
| InChIKey | NYYWRNKFNPDWFF-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.58 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|