C23H48N2O4 — CID 143545425
N-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-5,5,8,8-tetramethyl-12-(methylamino)dodecanamide (PubChem CID 143545425) has the molecular formula C23H48N2O4 and a molecular weight of 416.65 g/mol. Its IUPAC name is N-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-5,5,8,8-tetramethyl-12-(methylamino)dodecanamide.
| Compound Name | N-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-5,5,8,8-tetramethyl-12-(methylamino)dodecanamide |
|---|---|
| PubChem CID | 143545425 |
| Molecular Formula | C23H48N2O4 |
| Molecular Weight | 416.65 g/mol |
| Exact Mass | 416.36 |
| IUPAC Name | N-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-5,5,8,8-tetramethyl-12-(methylamino)dodecanamide |
| SMILES | CNCCCCC(C)(C)CCC(C)(C)CCCC(=O)NCCOCCOCCO |
| InChI | InChI=1S/C23H48N2O4/c1-22(2,10-6-7-14-24-5)12-13-23(3,4)11-8-9-21(27)25-15-17-28-19-20-29-18-16-26/h24,26H,6-20H2,1-5H3,(H,25,27) |
| InChIKey | LJKDEAUMSBDJJL-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.65 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|