C11H18F5NS — CID 145278551
(5E)-N,3-dimethyl-4-methylidene-6-(pentafluoro-λ6-sulfanyl)octa-5,7-dien-1-amine (PubChem CID 145278551) has the molecular formula C11H18F5NS and a molecular weight of 291.33 g/mol. Its IUPAC name is (5E)-N,3-dimethyl-4-methylidene-6-(pentafluoro-λ6-sulfanyl)octa-5,7-dien-1-amine.
| Compound Name | (5E)-N,3-dimethyl-4-methylidene-6-(pentafluoro-λ6-sulfanyl)octa-5,7-dien-1-amine |
|---|---|
| PubChem CID | 145278551 |
| Molecular Formula | C11H18F5NS |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | (5E)-N,3-dimethyl-4-methylidene-6-(pentafluoro-λ6-sulfanyl)octa-5,7-dien-1-amine |
| SMILES | C=C/C(=C\C(=C)C(C)CCNC)S(F)(F)(F)(F)F |
| InChI | InChI=1S/C11H18F5NS/c1-5-11(18(12,13,14,15)16)8-10(3)9(2)6-7-17-4/h5,8-9,17H,1,3,6-7H2,2,4H3/b11-8+ |
| InChIKey | BDGHKHKDRRLHNA-DHZHZOJOSA-N |
| XLogP | 5.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|