C14H28N2O3 — CID 159361137
(3S)-3,5-bis(methylamino)pentan-2-one;(3S)-3-ethyl-4-oxopentanal (PubChem CID 159361137) has the molecular formula C14H28N2O3 and a molecular weight of 272.39 g/mol. Its IUPAC name is (3S)-3,5-bis(methylamino)pentan-2-one;(3S)-3-ethyl-4-oxopentanal.
| Compound Name | (3S)-3,5-bis(methylamino)pentan-2-one;(3S)-3-ethyl-4-oxopentanal |
|---|---|
| PubChem CID | 159361137 |
| Molecular Formula | C14H28N2O3 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | (3S)-3,5-bis(methylamino)pentan-2-one;(3S)-3-ethyl-4-oxopentanal |
| SMILES | CC[C@@H](CC=O)C(C)=O.CNCC[C@H](NC)C(C)=O |
| InChI | InChI=1S/C7H16N2O.C7H12O2/c1-6(10)7(9-3)4-5-8-2;1-3-7(4-5-8)6(2)9/h7-9H,4-5H2,1-3H3;5,7H,3-4H2,1-2H3/t2*7-/m00/s1 |
| InChIKey | LIOAFLBKNGGVJQ-VGMFFHCQSA-N |
| XLogP | 0.96 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|