About aziridin-2-one;(3S)-3,5-bis(methylamino)pentan-2-one
aziridin-2-one;(3S)-3,5-bis(methylamino)pentan-2-one (PubChem CID 158944097) has the molecular formula C9H19N3O2
and a molecular weight of 201.27 g/mol. Its IUPAC name is aziridin-2-one;(3S)-3,5-bis(methylamino)pentan-2-one.
Molecular Properties
| Compound Name | aziridin-2-one;(3S)-3,5-bis(methylamino)pentan-2-one |
| PubChem CID | 158944097 |
| Molecular Formula | C9H19N3O2 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | aziridin-2-one;(3S)-3,5-bis(methylamino)pentan-2-one |
| SMILES | CNCC[C@H](NC)C(C)=O.O=C1CN1 |
| InChI | InChI=1S/C7H16N2O.C2H3NO/c1-6(10)7(9-3)4-5-8-2;4-2-1-3-2/h7-9H,4-5H2,1-3H3;1H2,(H,3,4)/t7-;/m0./s1 |
| InChIKey | JKPLZZKRSOFKHK-FJXQXJEOSA-N |
| XLogP | -1.11 |
| TPSA | 80.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze aziridin-2-one;(3S)-3,5-bis(methylamino)pentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aziridin-2-one;(3S)-3,5-bis(methylamino)pentan-2-one?
The IUPAC name of aziridin-2-one;(3S)-3,5-bis(methylamino)pentan-2-one (CID 158944097) is aziridin-2-one;(3S)-3,5-bis(methylamino)pentan-2-one.
What is the SMILES notation for aziridin-2-one;(3S)-3,5-bis(methylamino)pentan-2-one?
The canonical SMILES for aziridin-2-one;(3S)-3,5-bis(methylamino)pentan-2-one is CNCC[C@H](NC)C(C)=O.O=C1CN1.
What is the InChIKey of aziridin-2-one;(3S)-3,5-bis(methylamino)pentan-2-one?
The InChIKey is JKPLZZKRSOFKHK-FJXQXJEOSA-N. The full InChI is InChI=1S/C7H16N2O.C2H3NO/c1-6(10)7(9-3)4-5-8-2;4-2-1-3-2/h7-9H,4-5H2,1-3H3;1H2,(H,3,4)/t7-;/m0./s1.
What are the key properties of aziridin-2-one;(3S)-3,5-bis(methylamino)pentan-2-one?
aziridin-2-one;(3S)-3,5-bis(methylamino)pentan-2-one has a molecular weight of 201.27 g/mol, XLogP of -1.11, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for aziridin-2-one;(3S)-3,5-bis(methylamino)pentan-2-one is sourced from PubChem (CID 158944097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).