C17H34N2O3S2 — CID 161095635
(3S)-3,5-bis(methylamino)pentan-2-one;dithiirane;(3S)-3-ethylheptane-2,6-dione (PubChem CID 161095635) has the molecular formula C17H34N2O3S2 and a molecular weight of 378.60 g/mol. Its IUPAC name is (3S)-3,5-bis(methylamino)pentan-2-one;dithiirane;(3S)-3-ethylheptane-2,6-dione.
| Compound Name | (3S)-3,5-bis(methylamino)pentan-2-one;dithiirane;(3S)-3-ethylheptane-2,6-dione |
|---|---|
| PubChem CID | 161095635 |
| Molecular Formula | C17H34N2O3S2 |
| Molecular Weight | 378.60 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | (3S)-3,5-bis(methylamino)pentan-2-one;dithiirane;(3S)-3-ethylheptane-2,6-dione |
| SMILES | C1SS1.CC[C@@H](CCC(C)=O)C(C)=O.CNCC[C@H](NC)C(C)=O |
| InChI | InChI=1S/C9H16O2.C7H16N2O.CH2S2/c1-4-9(8(3)11)6-5-7(2)10;1-6(10)7(9-3)4-5-8-2;1-2-3-1/h9H,4-6H2,1-3H3;7-9H,4-5H2,1-3H3;1H2/t9-;7-;/m00./s1 |
| InChIKey | UHTGAABYBIRIIG-QOAIKHJGSA-N |
| XLogP | 3.08 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.60 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|