C25H47NO8 — CID 160681091
1-(2-butoxyethoxy)propan-2-one;2-ethyl-5-oxohexanoic acid;6-hydroxy-3-(methylamino)hept-6-en-2-one (PubChem CID 160681091) has the molecular formula C25H47NO8 and a molecular weight of 489.65 g/mol. Its IUPAC name is 1-(2-butoxyethoxy)propan-2-one;2-ethyl-5-oxohexanoic acid;6-hydroxy-3-(methylamino)hept-6-en-2-one.
| Compound Name | 1-(2-butoxyethoxy)propan-2-one;2-ethyl-5-oxohexanoic acid;6-hydroxy-3-(methylamino)hept-6-en-2-one |
|---|---|
| PubChem CID | 160681091 |
| Molecular Formula | C25H47NO8 |
| Molecular Weight | 489.65 g/mol |
| Exact Mass | 489.33 |
| IUPAC Name | 1-(2-butoxyethoxy)propan-2-one;2-ethyl-5-oxohexanoic acid;6-hydroxy-3-(methylamino)hept-6-en-2-one |
| SMILES | C=C(O)CCC(NC)C(C)=O.CCC(CCC(C)=O)C(=O)O.CCCCOCCOCC(C)=O |
| InChI | InChI=1S/C9H18O3.C8H15NO2.C8H14O3/c1-3-4-5-11-6-7-12-8-9(2)10;1-6(10)4-5-8(9-3)7(2)11;1-3-7(8(10)11)5-4-6(2)9/h3-8H2,1-2H3;8-10H,1,4-5H2,2-3H3;7H,3-5H2,1-2H3,(H,10,11) |
| InChIKey | RODPPOGXRUZITI-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 139.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.65 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|