C11H28N2 — CID 145117681
1-N,3-dimethylheptane-1,6-diamine;ethane (PubChem CID 145117681) has the molecular formula C11H28N2 and a molecular weight of 188.36 g/mol. Its IUPAC name is 1-N,3-dimethylheptane-1,6-diamine;ethane.
| Compound Name | 1-N,3-dimethylheptane-1,6-diamine;ethane |
|---|---|
| PubChem CID | 145117681 |
| Molecular Formula | C11H28N2 |
| Molecular Weight | 188.36 g/mol |
| Exact Mass | 188.23 |
| IUPAC Name | 1-N,3-dimethylheptane-1,6-diamine;ethane |
| SMILES | CC.CNCCC(C)CCC(C)N |
| InChI | InChI=1S/C9H22N2.C2H6/c1-8(6-7-11-3)4-5-9(2)10;1-2/h8-9,11H,4-7,10H2,1-3H3;1-2H3 |
| InChIKey | SKAQNIIUADKODJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.36 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |