About 4-sulfanylhexanal
4-sulfanylhexanal (PubChem CID 174812634) has the molecular formula C6H12OS
and a molecular weight of 132.23 g/mol. Its IUPAC name is 4-sulfanylhexanal.
Molecular Properties
| Compound Name | 4-sulfanylhexanal |
| PubChem CID | 174812634 |
| Molecular Formula | C6H12OS |
| Molecular Weight | 132.23 g/mol |
| Exact Mass | 132.06 |
| IUPAC Name | 4-sulfanylhexanal |
| SMILES | CCC(S)CCC=O |
| InChI | InChI=1S/C6H12OS/c1-2-6(8)4-3-5-7/h5-6,8H,2-4H2,1H3 |
| InChIKey | IXMWWAKEXPRAGE-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.23 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-sulfanylhexanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-sulfanylhexanal?
The IUPAC name of 4-sulfanylhexanal (CID 174812634) is 4-sulfanylhexanal.
What is the SMILES notation for 4-sulfanylhexanal?
The canonical SMILES for 4-sulfanylhexanal is CCC(S)CCC=O.
What is the InChIKey of 4-sulfanylhexanal?
The InChIKey is IXMWWAKEXPRAGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12OS/c1-2-6(8)4-3-5-7/h5-6,8H,2-4H2,1H3.
What are the key properties of 4-sulfanylhexanal?
4-sulfanylhexanal has a molecular weight of 132.23 g/mol, XLogP of 1.67, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-sulfanylhexanal is sourced from PubChem (CID 174812634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).