About 3-sulfanylpentanal
3-sulfanylpentanal (PubChem CID 527447) has the molecular formula C5H10OS
and a molecular weight of 118.20 g/mol. Its IUPAC name is 3-sulfanylpentanal.
Molecular Properties
| Compound Name | 3-sulfanylpentanal |
| PubChem CID | 527447 |
| Molecular Formula | C5H10OS |
| Molecular Weight | 118.20 g/mol |
| Exact Mass | 118.05 |
| IUPAC Name | 3-sulfanylpentanal |
| SMILES | CCC(S)CC=O |
| InChI | InChI=1S/C5H10OS/c1-2-5(7)3-4-6/h4-5,7H,2-3H2,1H3 |
| InChIKey | DLKSIGNUTFOJIC-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.20 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-sulfanylpentanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-sulfanylpentanal?
The IUPAC name of 3-sulfanylpentanal (CID 527447) is 3-sulfanylpentanal.
What is the SMILES notation for 3-sulfanylpentanal?
The canonical SMILES for 3-sulfanylpentanal is CCC(S)CC=O.
What is the InChIKey of 3-sulfanylpentanal?
The InChIKey is DLKSIGNUTFOJIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10OS/c1-2-5(7)3-4-6/h4-5,7H,2-3H2,1H3.
What are the key properties of 3-sulfanylpentanal?
3-sulfanylpentanal has a molecular weight of 118.20 g/mol, XLogP of 1.28, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-sulfanylpentanal is sourced from PubChem (CID 527447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).