About 3-butylsulfanylbutanal
3-butylsulfanylbutanal (PubChem CID 11423750) has the molecular formula C8H16OS
and a molecular weight of 160.28 g/mol. Its IUPAC name is 3-butylsulfanylbutanal.
Molecular Properties
| Compound Name | 3-butylsulfanylbutanal |
| PubChem CID | 11423750 |
| Molecular Formula | C8H16OS |
| Molecular Weight | 160.28 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | 3-butylsulfanylbutanal |
| SMILES | CCCCSC(C)CC=O |
| InChI | InChI=1S/C8H16OS/c1-3-4-7-10-8(2)5-6-9/h6,8H,3-5,7H2,1-2H3 |
| InChIKey | DNALOADTLFAEHE-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.28 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-butylsulfanylbutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butylsulfanylbutanal?
The IUPAC name of 3-butylsulfanylbutanal (CID 11423750) is 3-butylsulfanylbutanal.
What is the SMILES notation for 3-butylsulfanylbutanal?
The canonical SMILES for 3-butylsulfanylbutanal is CCCCSC(C)CC=O.
What is the InChIKey of 3-butylsulfanylbutanal?
The InChIKey is DNALOADTLFAEHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16OS/c1-3-4-7-10-8(2)5-6-9/h6,8H,3-5,7H2,1-2H3.
What are the key properties of 3-butylsulfanylbutanal?
3-butylsulfanylbutanal has a molecular weight of 160.28 g/mol, XLogP of 2.50, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butylsulfanylbutanal is sourced from PubChem (CID 11423750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).