C11H22OS2 — CID 15211174
2,3-bis(butylsulfanyl)propanal (PubChem CID 15211174) has the molecular formula C11H22OS2 and a molecular weight of 234.43 g/mol. Its IUPAC name is 2,3-bis(butylsulfanyl)propanal.
| Compound Name | 2,3-bis(butylsulfanyl)propanal |
|---|---|
| PubChem CID | 15211174 |
| Molecular Formula | C11H22OS2 |
| Molecular Weight | 234.43 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 2,3-bis(butylsulfanyl)propanal |
| SMILES | CCCCSCC(C=O)SCCCC |
| InChI | InChI=1S/C11H22OS2/c1-3-5-7-13-10-11(9-12)14-8-6-4-2/h9,11H,3-8,10H2,1-2H3 |
| InChIKey | BUMQUDGXPMMAAD-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.43 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|