C7H16S5 — CID 174986616
1,1-bis(sulfanylmethylsulfanyl)pentane-3-thiol (PubChem CID 174986616) has the molecular formula C7H16S5 and a molecular weight of 260.54 g/mol. Its IUPAC name is 1,1-bis(sulfanylmethylsulfanyl)pentane-3-thiol.
| Compound Name | 1,1-bis(sulfanylmethylsulfanyl)pentane-3-thiol |
|---|---|
| PubChem CID | 174986616 |
| Molecular Formula | C7H16S5 |
| Molecular Weight | 260.54 g/mol |
| Exact Mass | 259.99 |
| IUPAC Name | 1,1-bis(sulfanylmethylsulfanyl)pentane-3-thiol |
| SMILES | CCC(S)CC(SCS)SCS |
| InChI | InChI=1S/C7H16S5/c1-2-6(10)3-7(11-4-8)12-5-9/h6-10H,2-5H2,1H3 |
| InChIKey | UBUFTTBBJOHKFI-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.54 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|