C10H22S10 — CID 156700219
1,1,6,6-tetrakis(sulfanylmethylsulfanyl)hexane-3,4-dithiol (PubChem CID 156700219) has the molecular formula C10H22S10 and a molecular weight of 462.96 g/mol. Its IUPAC name is 1,1,6,6-tetrakis(sulfanylmethylsulfanyl)hexane-3,4-dithiol.
| Compound Name | 1,1,6,6-tetrakis(sulfanylmethylsulfanyl)hexane-3,4-dithiol |
|---|---|
| PubChem CID | 156700219 |
| Molecular Formula | C10H22S10 |
| Molecular Weight | 462.96 g/mol |
| Exact Mass | 461.89 |
| IUPAC Name | 1,1,6,6-tetrakis(sulfanylmethylsulfanyl)hexane-3,4-dithiol |
| SMILES | SCSC(CC(S)C(S)CC(SCS)SCS)SCS |
| InChI | InChI=1S/C10H22S10/c11-3-17-9(18-4-12)1-7(15)8(16)2-10(19-5-13)20-6-14/h7-16H,1-6H2 |
| InChIKey | CGCDSCKPOPEPSD-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.96 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|