C6H14S6 — CID 158891475
2-[1,2-bis(sulfanylmethylsulfanyl)ethylsulfanyl]ethanethiol (PubChem CID 158891475) has the molecular formula C6H14S6 and a molecular weight of 278.58 g/mol. Its IUPAC name is 2-[1,2-bis(sulfanylmethylsulfanyl)ethylsulfanyl]ethanethiol.
| Compound Name | 2-[1,2-bis(sulfanylmethylsulfanyl)ethylsulfanyl]ethanethiol |
|---|---|
| PubChem CID | 158891475 |
| Molecular Formula | C6H14S6 |
| Molecular Weight | 278.58 g/mol |
| Exact Mass | 277.94 |
| IUPAC Name | 2-[1,2-bis(sulfanylmethylsulfanyl)ethylsulfanyl]ethanethiol |
| SMILES | SCCSC(CSCS)SCS |
| InChI | InChI=1S/C6H14S6/c7-1-2-11-6(12-5-9)3-10-4-8/h6-9H,1-5H2 |
| InChIKey | JEHGZVMJDUHLFH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.58 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|