C9H20S5 — CID 170374294
1-[3-sulfanyl-2-(2-sulfanylethylsulfanyl)propyl]sulfanylbutane-2-thiol (PubChem CID 170374294) has the molecular formula C9H20S5 and a molecular weight of 288.59 g/mol. Its IUPAC name is 1-[3-sulfanyl-2-(2-sulfanylethylsulfanyl)propyl]sulfanylbutane-2-thiol.
| Compound Name | 1-[3-sulfanyl-2-(2-sulfanylethylsulfanyl)propyl]sulfanylbutane-2-thiol |
|---|---|
| PubChem CID | 170374294 |
| Molecular Formula | C9H20S5 |
| Molecular Weight | 288.59 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | 1-[3-sulfanyl-2-(2-sulfanylethylsulfanyl)propyl]sulfanylbutane-2-thiol |
| SMILES | CCC(S)CSCC(CS)SCCS |
| InChI | InChI=1S/C9H20S5/c1-2-8(12)6-13-7-9(5-11)14-4-3-10/h8-12H,2-7H2,1H3 |
| InChIKey | TYEMTHRRGGRSQP-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.59 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|