C8H18S5 — CID 87523690
1-[1-sulfanyl-2-(2-sulfanylethylsulfanyl)ethyl]sulfanylbutane-2-thiol (PubChem CID 87523690) has the molecular formula C8H18S5 and a molecular weight of 274.57 g/mol. Its IUPAC name is 1-[1-sulfanyl-2-(2-sulfanylethylsulfanyl)ethyl]sulfanylbutane-2-thiol.
| Compound Name | 1-[1-sulfanyl-2-(2-sulfanylethylsulfanyl)ethyl]sulfanylbutane-2-thiol |
|---|---|
| PubChem CID | 87523690 |
| Molecular Formula | C8H18S5 |
| Molecular Weight | 274.57 g/mol |
| Exact Mass | 274.00 |
| IUPAC Name | 1-[1-sulfanyl-2-(2-sulfanylethylsulfanyl)ethyl]sulfanylbutane-2-thiol |
| SMILES | CCC(S)CSC(S)CSCCS |
| InChI | InChI=1S/C8H18S5/c1-2-7(10)5-13-8(11)6-12-4-3-9/h7-11H,2-6H2,1H3 |
| InChIKey | XXUUQTZVUXKDKN-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.57 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|